C26H26N6O2S2 — CID 129101773
butyl 4-[[2-[(4-pyrrolidin-1-ylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]benzoate (PubChem CID 129101773) has the molecular formula C26H26N6O2S2 and a molecular weight of 518.67 g/mol. Its IUPAC name is butyl 4-[[2-[(4-pyrrolidin-1-ylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]benzoate.
| Compound Name | butyl 4-[[2-[(4-pyrrolidin-1-ylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]benzoate |
|---|---|
| PubChem CID | 129101773 |
| Molecular Formula | C26H26N6O2S2 |
| Molecular Weight | 518.67 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | butyl 4-[[2-[(4-pyrrolidin-1-ylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(/N=N/c2cc3sc(/N=N/c4ccc(N5CCCC5)cc4)nc3s2)cc1 |
| InChI | InChI=1S/C26H26N6O2S2/c1-2-3-16-34-25(33)18-6-8-19(9-7-18)28-30-23-17-22-24(36-23)27-26(35-22)31-29-20-10-12-21(13-11-20)32-14-4-5-15-32/h6-13,17H,2-5,14-16H2,1H3/b30-28+,31-29+ |
| InChIKey | MIUQGDFTEZXQPW-FUEWEDNTSA-N |
| XLogP | 8.75 |
| TPSA | 91.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.67 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|