C34H31N5O2S2 — CID 170369009
hexyl 4-[(Z)-1-cyano-2-[2-[[4-(N-methylanilino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]ethenyl]benzoate (PubChem CID 170369009) has the molecular formula C34H31N5O2S2 and a molecular weight of 605.79 g/mol. Its IUPAC name is hexyl 4-[(Z)-1-cyano-2-[2-[[4-(N-methylanilino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]ethenyl]benzoate.
| Compound Name | hexyl 4-[(Z)-1-cyano-2-[2-[[4-(N-methylanilino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]ethenyl]benzoate |
|---|---|
| PubChem CID | 170369009 |
| Molecular Formula | C34H31N5O2S2 |
| Molecular Weight | 605.79 g/mol |
| Exact Mass | 605.19 |
| IUPAC Name | hexyl 4-[(Z)-1-cyano-2-[2-[[4-(N-methylanilino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]ethenyl]benzoate |
| SMILES | CCCCCCOC(=O)c1ccc(/C(C#N)=C/c2cc3sc(/N=N/c4ccc(N(C)c5ccccc5)cc4)nc3s2)cc1 |
| InChI | InChI=1S/C34H31N5O2S2/c1-3-4-5-9-20-41-33(40)25-14-12-24(13-15-25)26(23-35)21-30-22-31-32(42-30)36-34(43-31)38-37-27-16-18-29(19-17-27)39(2)28-10-7-6-8-11-28/h6-8,10-19,21-22H,3-5,9,20H2,1-2H3/b26-21+,38-37+ |
| InChIKey | AAMHYCYSYHHORZ-OEWCPJONSA-N |
| XLogP | 10.34 |
| TPSA | 90.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.79 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|