C21H24N4O4S2 — CID 140912363
4-O-[2-[4-[(2-aminothieno[2,3-d][1,3]thiazol-5-yl)diazenyl]phenyl]ethyl] 1-O-butyl butanedioate (PubChem CID 140912363) has the molecular formula C21H24N4O4S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 4-O-[2-[4-[(2-aminothieno[2,3-d][1,3]thiazol-5-yl)diazenyl]phenyl]ethyl] 1-O-butyl butanedioate.
| Compound Name | 4-O-[2-[4-[(2-aminothieno[2,3-d][1,3]thiazol-5-yl)diazenyl]phenyl]ethyl] 1-O-butyl butanedioate |
|---|---|
| PubChem CID | 140912363 |
| Molecular Formula | C21H24N4O4S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 4-O-[2-[4-[(2-aminothieno[2,3-d][1,3]thiazol-5-yl)diazenyl]phenyl]ethyl] 1-O-butyl butanedioate |
| SMILES | CCCCOC(=O)CCC(=O)OCCc1ccc(/N=N/c2cc3sc(N)nc3s2)cc1 |
| InChI | InChI=1S/C21H24N4O4S2/c1-2-3-11-28-18(26)8-9-19(27)29-12-10-14-4-6-15(7-5-14)24-25-17-13-16-20(31-17)23-21(22)30-16/h4-7,13H,2-3,8-12H2,1H3,(H2,22,23)/b25-24+ |
| InChIKey | QHRXSKQXSAPFRZ-OCOZRVBESA-N |
| XLogP | 5.56 |
| TPSA | 116.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|