C28H30N6O3S — CID 145123664
2-[[2-[[(3Z)-5-[[4-(diethylamino)phenyl]diazenyl]hexa-1,3,5-trien-2-yl]diazenyl]-1,3-benzothiazol-6-yl]oxy]ethyl prop-2-enoate (PubChem CID 145123664) has the molecular formula C28H30N6O3S and a molecular weight of 530.65 g/mol. Its IUPAC name is 2-[[2-[[(3Z)-5-[[4-(diethylamino)phenyl]diazenyl]hexa-1,3,5-trien-2-yl]diazenyl]-1,3-benzothiazol-6-yl]oxy]ethyl prop-2-enoate.
| Compound Name | 2-[[2-[[(3Z)-5-[[4-(diethylamino)phenyl]diazenyl]hexa-1,3,5-trien-2-yl]diazenyl]-1,3-benzothiazol-6-yl]oxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 145123664 |
| Molecular Formula | C28H30N6O3S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | 2-[[2-[[(3Z)-5-[[4-(diethylamino)phenyl]diazenyl]hexa-1,3,5-trien-2-yl]diazenyl]-1,3-benzothiazol-6-yl]oxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1ccc2nc(/N=N/C(=C)/C=C\C(=C)/N=N/c3ccc(N(CC)CC)cc3)sc2c1 |
| InChI | InChI=1S/C28H30N6O3S/c1-6-27(35)37-18-17-36-24-15-16-25-26(19-24)38-28(29-25)33-31-21(5)10-9-20(4)30-32-22-11-13-23(14-12-22)34(7-2)8-3/h6,9-16,19H,1,4-5,7-8,17-18H2,2-3H3/b10-9-,32-30+,33-31+ |
| InChIKey | MMPUTPILZRVGEU-QWNPSNFWSA-N |
| XLogP | 7.70 |
| TPSA | 101.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|