C32H27N7OS2 — CID 165365238
(4-butoxyphenyl)-[4-[[4-[(5-methylthieno[2,3-d][1,3]thiazol-2-yl)diazenyl]phenyl]diazenyl]naphthalen-1-yl]diazene (PubChem CID 165365238) has the molecular formula C32H27N7OS2 and a molecular weight of 589.75 g/mol. Its IUPAC name is (4-butoxyphenyl)-[4-[[4-[(5-methylthieno[2,3-d][1,3]thiazol-2-yl)diazenyl]phenyl]diazenyl]naphthalen-1-yl]diazene.
| Compound Name | (4-butoxyphenyl)-[4-[[4-[(5-methylthieno[2,3-d][1,3]thiazol-2-yl)diazenyl]phenyl]diazenyl]naphthalen-1-yl]diazene |
|---|---|
| PubChem CID | 165365238 |
| Molecular Formula | C32H27N7OS2 |
| Molecular Weight | 589.75 g/mol |
| Exact Mass | 589.17 |
| IUPAC Name | (4-butoxyphenyl)-[4-[[4-[(5-methylthieno[2,3-d][1,3]thiazol-2-yl)diazenyl]phenyl]diazenyl]naphthalen-1-yl]diazene |
| SMILES | CCCCOc1ccc(/N=N/c2ccc(/N=N/c3ccc(/N=N/c4nc5sc(C)cc5s4)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C32H27N7OS2/c1-3-4-19-40-25-15-13-24(14-16-25)35-38-29-18-17-28(26-7-5-6-8-27(26)29)37-34-22-9-11-23(12-10-22)36-39-32-33-31-30(42-32)20-21(2)41-31/h5-18,20H,3-4,19H2,1-2H3/b37-34+,38-35+,39-36+ |
| InChIKey | HRFINTHSXFWLPT-GMHCBVOVSA-N |
| XLogP | 12.24 |
| TPSA | 96.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.75 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|