C22H21N3O2S — CID 136846941
4-butoxy-2-[(6-methyl-1,3-benzothiazol-2-yl)diazenyl]naphthalen-1-ol (PubChem CID 136846941) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is 4-butoxy-2-[(6-methyl-1,3-benzothiazol-2-yl)diazenyl]naphthalen-1-ol.
| Compound Name | 4-butoxy-2-[(6-methyl-1,3-benzothiazol-2-yl)diazenyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 136846941 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 4-butoxy-2-[(6-methyl-1,3-benzothiazol-2-yl)diazenyl]naphthalen-1-ol |
| SMILES | CCCCOc1cc(/N=N/c2nc3ccc(C)cc3s2)c(O)c2ccccc12 |
| InChI | InChI=1S/C22H21N3O2S/c1-3-4-11-27-19-13-18(21(26)16-8-6-5-7-15(16)19)24-25-22-23-17-10-9-14(2)12-20(17)28-22/h5-10,12-13,26H,3-4,11H2,1-2H3/b25-24+ |
| InChIKey | OLTZHRBXMNIPQO-OCOZRVBESA-N |
| XLogP | 7.06 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|