C21H14ClN3O2S — CID 171714712
[2-[(6-methyl-1,3-benzothiazol-2-yl)diazenyl]phenyl] 4-chlorobenzoate (PubChem CID 171714712) has the molecular formula C21H14ClN3O2S and a molecular weight of 407.88 g/mol. Its IUPAC name is [2-[(6-methyl-1,3-benzothiazol-2-yl)diazenyl]phenyl] 4-chlorobenzoate.
| Compound Name | [2-[(6-methyl-1,3-benzothiazol-2-yl)diazenyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 171714712 |
| Molecular Formula | C21H14ClN3O2S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | [2-[(6-methyl-1,3-benzothiazol-2-yl)diazenyl]phenyl] 4-chlorobenzoate |
| SMILES | Cc1ccc2nc(/N=N/c3ccccc3OC(=O)c3ccc(Cl)cc3)sc2c1 |
| InChI | InChI=1S/C21H14ClN3O2S/c1-13-6-11-17-19(12-13)28-21(23-17)25-24-16-4-2-3-5-18(16)27-20(26)14-7-9-15(22)10-8-14/h2-12H,1H3/b25-24+ |
| InChIKey | NSCJNHSCKNPMES-OCOZRVBESA-N |
| XLogP | 6.89 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|