About N-butyl-4-[(5,6-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-(2-phenoxyethyl)aniline
N-butyl-4-[(5,6-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-(2-phenoxyethyl)aniline (PubChem CID 14205078) has the molecular formula C25H24Cl2N4OS
and a molecular weight of 499.47 g/mol. Its IUPAC name is N-butyl-4-[(5,6-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-(2-phenoxyethyl)aniline.
Molecular Properties
| Compound Name | N-butyl-4-[(5,6-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-(2-phenoxyethyl)aniline |
| PubChem CID | 14205078 |
| Molecular Formula | C25H24Cl2N4OS |
| Molecular Weight | 499.47 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | N-butyl-4-[(5,6-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-(2-phenoxyethyl)aniline |
| SMILES | CCCCN(CCOc1ccccc1)c1ccc(/N=N/c2nc3cc(Cl)c(Cl)cc3s2)cc1 |
| InChI | InChI=1S/C25H24Cl2N4OS/c1-2-3-13-31(14-15-32-20-7-5-4-6-8-20)19-11-9-18(10-12-19)29-30-25-28-23-16-21(26)22(27)17-24(23)33-25/h4-12,16-17H,2-3,13-15H2,1H3/b30-29+ |
| InChIKey | ZISWXTFECWHOEM-QVIHXGFCSA-N |
| XLogP | 8.70 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.47 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-4-[(5,6-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-(2-phenoxyethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-4-[(5,6-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-(2-phenoxyethyl)aniline?
The IUPAC name of N-butyl-4-[(5,6-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-(2-phenoxyethyl)aniline (CID 14205078) is N-butyl-4-[(5,6-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-(2-phenoxyethyl)aniline.
What is the SMILES notation for N-butyl-4-[(5,6-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-(2-phenoxyethyl)aniline?
The canonical SMILES for N-butyl-4-[(5,6-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-(2-phenoxyethyl)aniline is CCCCN(CCOc1ccccc1)c1ccc(/N=N/c2nc3cc(Cl)c(Cl)cc3s2)cc1.
What is the InChIKey of N-butyl-4-[(5,6-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-(2-phenoxyethyl)aniline?
The InChIKey is ZISWXTFECWHOEM-QVIHXGFCSA-N. The full InChI is InChI=1S/C25H24Cl2N4OS/c1-2-3-13-31(14-15-32-20-7-5-4-6-8-20)19-11-9-18(10-12-19)29-30-25-28-23-16-21(26)22(27)17-24(23)33-25/h4-12,16-17H,2-3,13-15H2,1H3/b30-29+.
What are the key properties of N-butyl-4-[(5,6-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-(2-phenoxyethyl)aniline?
N-butyl-4-[(5,6-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-(2-phenoxyethyl)aniline has a molecular weight of 499.47 g/mol, XLogP of 8.70, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-4-[(5,6-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-(2-phenoxyethyl)aniline is sourced from PubChem (CID 14205078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).