C18H20ClF3N4O4S2 — CID 23151848
2-chloro-N-[4-[[6-(dimethylamino)-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]butyl]-5-nitrobenzenesulfonamide (PubChem CID 23151848) has the molecular formula C18H20ClF3N4O4S2 and a molecular weight of 512.96 g/mol. Its IUPAC name is 2-chloro-N-[4-[[6-(dimethylamino)-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]butyl]-5-nitrobenzenesulfonamide.
| Compound Name | 2-chloro-N-[4-[[6-(dimethylamino)-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]butyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 23151848 |
| Molecular Formula | C18H20ClF3N4O4S2 |
| Molecular Weight | 512.96 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | 2-chloro-N-[4-[[6-(dimethylamino)-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]butyl]-5-nitrobenzenesulfonamide |
| SMILES | CN(C)c1cc(C(F)(F)F)cc(SCCCCNS(=O)(=O)c2cc([N+](=O)[O-])ccc2Cl)n1 |
| InChI | InChI=1S/C18H20ClF3N4O4S2/c1-25(2)16-9-12(18(20,21)22)10-17(24-16)31-8-4-3-7-23-32(29,30)15-11-13(26(27)28)5-6-14(15)19/h5-6,9-11,23H,3-4,7-8H2,1-2H3 |
| InChIKey | OLTFYYOVUJTFGX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.96 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|