C16H12Cl2F3N3O5S — CID 74019040
2-chloro-N-[4-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]oxy]but-2-enyl]-5-nitrobenzenesulfonamide (PubChem CID 74019040) has the molecular formula C16H12Cl2F3N3O5S and a molecular weight of 486.26 g/mol. Its IUPAC name is 2-chloro-N-[4-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]oxy]but-2-enyl]-5-nitrobenzenesulfonamide.
| Compound Name | 2-chloro-N-[4-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]oxy]but-2-enyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 74019040 |
| Molecular Formula | C16H12Cl2F3N3O5S |
| Molecular Weight | 486.26 g/mol |
| Exact Mass | 484.98 |
| IUPAC Name | 2-chloro-N-[4-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]oxy]but-2-enyl]-5-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(S(=O)(=O)NCC=CCOc2cc(C(F)(F)F)cc(Cl)n2)c1 |
| InChI | InChI=1S/C16H12Cl2F3N3O5S/c17-12-4-3-11(24(25)26)9-13(12)30(27,28)22-5-1-2-6-29-15-8-10(16(19,20)21)7-14(18)23-15/h1-4,7-9,22H,5-6H2 |
| InChIKey | PJKPFRGJJKIJEC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.26 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|