C16H15ClN4O7S — CID 23152128
2-chloro-N-[4-(4,6-dimethoxypyrimidin-2-yl)oxybut-2-ynyl]-5-nitrobenzenesulfonamide (PubChem CID 23152128) has the molecular formula C16H15ClN4O7S and a molecular weight of 442.84 g/mol. Its IUPAC name is 2-chloro-N-[4-(4,6-dimethoxypyrimidin-2-yl)oxybut-2-ynyl]-5-nitrobenzenesulfonamide.
| Compound Name | 2-chloro-N-[4-(4,6-dimethoxypyrimidin-2-yl)oxybut-2-ynyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 23152128 |
| Molecular Formula | C16H15ClN4O7S |
| Molecular Weight | 442.84 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | 2-chloro-N-[4-(4,6-dimethoxypyrimidin-2-yl)oxybut-2-ynyl]-5-nitrobenzenesulfonamide |
| SMILES | COc1cc(OC)nc(OCC#CCNS(=O)(=O)c2cc([N+](=O)[O-])ccc2Cl)n1 |
| InChI | InChI=1S/C16H15ClN4O7S/c1-26-14-10-15(27-2)20-16(19-14)28-8-4-3-7-18-29(24,25)13-9-11(21(22)23)5-6-12(13)17/h5-6,9-10,18H,7-8H2,1-2H3 |
| InChIKey | YZXCEZFISGMNTE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.84 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|