C21H19Cl2N5O5S — CID 121059304
2,3-dichloro-N-[2-[[3-(2,4-dimethoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]benzenesulfonamide (PubChem CID 121059304) has the molecular formula C21H19Cl2N5O5S and a molecular weight of 524.39 g/mol. Its IUPAC name is 2,3-dichloro-N-[2-[[3-(2,4-dimethoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]benzenesulfonamide.
| Compound Name | 2,3-dichloro-N-[2-[[3-(2,4-dimethoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121059304 |
| Molecular Formula | C21H19Cl2N5O5S |
| Molecular Weight | 524.39 g/mol |
| Exact Mass | 523.05 |
| IUPAC Name | 2,3-dichloro-N-[2-[[3-(2,4-dimethoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]benzenesulfonamide |
| SMILES | COc1ccc(-c2nnc3ccc(OCCNS(=O)(=O)c4cccc(Cl)c4Cl)nn23)c(OC)c1 |
| InChI | InChI=1S/C21H19Cl2N5O5S/c1-31-13-6-7-14(16(12-13)32-2)21-26-25-18-8-9-19(27-28(18)21)33-11-10-24-34(29,30)17-5-3-4-15(22)20(17)23/h3-9,12,24H,10-11H2,1-2H3 |
| InChIKey | BJILUHKSYSZLGG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|