C25H27N5O5 — CID 121059455
2-(4-ethoxyphenoxy)-N-[2-[[3-(2-methoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]propanamide (PubChem CID 121059455) has the molecular formula C25H27N5O5 and a molecular weight of 477.52 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)-N-[2-[[3-(2-methoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]propanamide.
| Compound Name | 2-(4-ethoxyphenoxy)-N-[2-[[3-(2-methoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]propanamide |
|---|---|
| PubChem CID | 121059455 |
| Molecular Formula | C25H27N5O5 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 2-(4-ethoxyphenoxy)-N-[2-[[3-(2-methoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]propanamide |
| SMILES | CCOc1ccc(OC(C)C(=O)NCCOc2ccc3nnc(-c4ccccc4OC)n3n2)cc1 |
| InChI | InChI=1S/C25H27N5O5/c1-4-33-18-9-11-19(12-10-18)35-17(2)25(31)26-15-16-34-23-14-13-22-27-28-24(30(22)29-23)20-7-5-6-8-21(20)32-3/h5-14,17H,4,15-16H2,1-3H3,(H,26,31) |
| InChIKey | CZDLMXCXNGMSOZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|