C24H25N5O4 — CID 121059397
2-(4-ethoxyphenoxy)-N-[2-[(3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxy]ethyl]propanamide (PubChem CID 121059397) has the molecular formula C24H25N5O4 and a molecular weight of 447.50 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)-N-[2-[(3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxy]ethyl]propanamide.
| Compound Name | 2-(4-ethoxyphenoxy)-N-[2-[(3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxy]ethyl]propanamide |
|---|---|
| PubChem CID | 121059397 |
| Molecular Formula | C24H25N5O4 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 2-(4-ethoxyphenoxy)-N-[2-[(3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxy]ethyl]propanamide |
| SMILES | CCOc1ccc(OC(C)C(=O)NCCOc2ccc3nnc(-c4ccccc4)n3n2)cc1 |
| InChI | InChI=1S/C24H25N5O4/c1-3-31-19-9-11-20(12-10-19)33-17(2)24(30)25-15-16-32-22-14-13-21-26-27-23(29(21)28-22)18-7-5-4-6-8-18/h4-14,17H,3,15-16H2,1-2H3,(H,25,30) |
| InChIKey | OXERFQFGRLVWHW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|