C23H20ClN5O5 — CID 121059489
2-(1,3-benzodioxol-5-yloxy)-N-[2-[[3-(2-chlorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]propanamide (PubChem CID 121059489) has the molecular formula C23H20ClN5O5 and a molecular weight of 481.90 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-N-[2-[[3-(2-chlorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]propanamide.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-N-[2-[[3-(2-chlorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]propanamide |
|---|---|
| PubChem CID | 121059489 |
| Molecular Formula | C23H20ClN5O5 |
| Molecular Weight | 481.90 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-N-[2-[[3-(2-chlorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]propanamide |
| SMILES | CC(Oc1ccc2c(c1)OCO2)C(=O)NCCOc1ccc2nnc(-c3ccccc3Cl)n2n1 |
| InChI | InChI=1S/C23H20ClN5O5/c1-14(34-15-6-7-18-19(12-15)33-13-32-18)23(30)25-10-11-31-21-9-8-20-26-27-22(29(20)28-21)16-4-2-3-5-17(16)24/h2-9,12,14H,10-11,13H2,1H3,(H,25,30) |
| InChIKey | ZZXFZMPHTULRJR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.90 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|