C26H29N5O5 — CID 121059512
N-[2-[[3-(2,4-dimethoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-2-(3,5-dimethylphenoxy)propanamide (PubChem CID 121059512) has the molecular formula C26H29N5O5 and a molecular weight of 491.55 g/mol. Its IUPAC name is N-[2-[[3-(2,4-dimethoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-2-(3,5-dimethylphenoxy)propanamide.
| Compound Name | N-[2-[[3-(2,4-dimethoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-2-(3,5-dimethylphenoxy)propanamide |
|---|---|
| PubChem CID | 121059512 |
| Molecular Formula | C26H29N5O5 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | N-[2-[[3-(2,4-dimethoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-2-(3,5-dimethylphenoxy)propanamide |
| SMILES | COc1ccc(-c2nnc3ccc(OCCNC(=O)C(C)Oc4cc(C)cc(C)c4)nn23)c(OC)c1 |
| InChI | InChI=1S/C26H29N5O5/c1-16-12-17(2)14-20(13-16)36-18(3)26(32)27-10-11-35-24-9-8-23-28-29-25(31(23)30-24)21-7-6-19(33-4)15-22(21)34-5/h6-9,12-15,18H,10-11H2,1-5H3,(H,27,32) |
| InChIKey | JMGNOUOBADBOJW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|