C20H16Cl3N5O4S — CID 121059266
2,4,5-trichloro-N-[2-[[3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]benzenesulfonamide (PubChem CID 121059266) has the molecular formula C20H16Cl3N5O4S and a molecular weight of 528.81 g/mol. Its IUPAC name is 2,4,5-trichloro-N-[2-[[3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]benzenesulfonamide.
| Compound Name | 2,4,5-trichloro-N-[2-[[3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121059266 |
| Molecular Formula | C20H16Cl3N5O4S |
| Molecular Weight | 528.81 g/mol |
| Exact Mass | 527.00 |
| IUPAC Name | 2,4,5-trichloro-N-[2-[[3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]benzenesulfonamide |
| SMILES | COc1ccc(-c2nnc3ccc(OCCNS(=O)(=O)c4cc(Cl)c(Cl)cc4Cl)nn23)cc1 |
| InChI | InChI=1S/C20H16Cl3N5O4S/c1-31-13-4-2-12(3-5-13)20-26-25-18-6-7-19(27-28(18)20)32-9-8-24-33(29,30)17-11-15(22)14(21)10-16(17)23/h2-7,10-11,24H,8-9H2,1H3 |
| InChIKey | CQMAUWCKNFKUFI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.81 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|