C23H24N6O3 — CID 121057790
4-(dimethylamino)-N-[2-[[3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]benzamide (PubChem CID 121057790) has the molecular formula C23H24N6O3 and a molecular weight of 432.48 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[2-[[3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]benzamide.
| Compound Name | 4-(dimethylamino)-N-[2-[[3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]benzamide |
|---|---|
| PubChem CID | 121057790 |
| Molecular Formula | C23H24N6O3 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 4-(dimethylamino)-N-[2-[[3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]benzamide |
| SMILES | COc1ccc(-c2nnc3ccc(OCCNC(=O)c4ccc(N(C)C)cc4)nn23)cc1 |
| InChI | InChI=1S/C23H24N6O3/c1-28(2)18-8-4-17(5-9-18)23(30)24-14-15-32-21-13-12-20-25-26-22(29(20)27-21)16-6-10-19(31-3)11-7-16/h4-13H,14-15H2,1-3H3,(H,24,30) |
| InChIKey | ORDPCPWTXOLIPM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|