C24H23N5O5 — CID 121057861
N-[2-[[3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-2-methyl-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 121057861) has the molecular formula C24H23N5O5 and a molecular weight of 461.48 g/mol. Its IUPAC name is N-[2-[[3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-2-methyl-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | N-[2-[[3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-2-methyl-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 121057861 |
| Molecular Formula | C24H23N5O5 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | N-[2-[[3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-2-methyl-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | COc1ccc(-c2nnc3ccc(OCCNC(=O)C4Oc5ccccc5OC4C)nn23)cc1 |
| InChI | InChI=1S/C24H23N5O5/c1-15-22(34-19-6-4-3-5-18(19)33-15)24(30)25-13-14-32-21-12-11-20-26-27-23(29(20)28-21)16-7-9-17(31-2)10-8-16/h3-12,15,22H,13-14H2,1-2H3,(H,25,30) |
| InChIKey | PAPSTBCWOULPAD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|