C25H23F3N6O5S — CID 121059274
N-[2-[[3-(2-methoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-2-methyl-1-(2,2,2-trifluoroacetyl)-2,3-dihydroindole-5-sulfonamide (PubChem CID 121059274) has the molecular formula C25H23F3N6O5S and a molecular weight of 576.56 g/mol. Its IUPAC name is N-[2-[[3-(2-methoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-2-methyl-1-(2,2,2-trifluoroacetyl)-2,3-dihydroindole-5-sulfonamide.
| Compound Name | N-[2-[[3-(2-methoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-2-methyl-1-(2,2,2-trifluoroacetyl)-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 121059274 |
| Molecular Formula | C25H23F3N6O5S |
| Molecular Weight | 576.56 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | N-[2-[[3-(2-methoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-2-methyl-1-(2,2,2-trifluoroacetyl)-2,3-dihydroindole-5-sulfonamide |
| SMILES | COc1ccccc1-c1nnc2ccc(OCCNS(=O)(=O)c3ccc4c(c3)CC(C)N4C(=O)C(F)(F)F)nn12 |
| InChI | InChI=1S/C25H23F3N6O5S/c1-15-13-16-14-17(7-8-19(16)33(15)24(35)25(26,27)28)40(36,37)29-11-12-39-22-10-9-21-30-31-23(34(21)32-22)18-5-3-4-6-20(18)38-2/h3-10,14-15,29H,11-13H2,1-2H3 |
| InChIKey | PQXHTEMZZIMFFL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 128.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.56 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|