C26H25F3N6O6S — CID 121059350
N-[2-[[3-(3,4-dimethoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-2-methyl-1-(2,2,2-trifluoroacetyl)-2,3-dihydroindole-5-sulfonamide (PubChem CID 121059350) has the molecular formula C26H25F3N6O6S and a molecular weight of 606.58 g/mol. Its IUPAC name is N-[2-[[3-(3,4-dimethoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-2-methyl-1-(2,2,2-trifluoroacetyl)-2,3-dihydroindole-5-sulfonamide.
| Compound Name | N-[2-[[3-(3,4-dimethoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-2-methyl-1-(2,2,2-trifluoroacetyl)-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 121059350 |
| Molecular Formula | C26H25F3N6O6S |
| Molecular Weight | 606.58 g/mol |
| Exact Mass | 606.15 |
| IUPAC Name | N-[2-[[3-(3,4-dimethoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-2-methyl-1-(2,2,2-trifluoroacetyl)-2,3-dihydroindole-5-sulfonamide |
| SMILES | COc1ccc(-c2nnc3ccc(OCCNS(=O)(=O)c4ccc5c(c4)CC(C)N5C(=O)C(F)(F)F)nn23)cc1OC |
| InChI | InChI=1S/C26H25F3N6O6S/c1-15-12-17-13-18(5-6-19(17)34(15)25(36)26(27,28)29)42(37,38)30-10-11-41-23-9-8-22-31-32-24(35(22)33-23)16-4-7-20(39-2)21(14-16)40-3/h4-9,13-15,30H,10-12H2,1-3H3 |
| InChIKey | ZIQQNUACFIIFBC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 137.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.58 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|