C19H14F3N5O3S — CID 121059394
2,6-difluoro-N-[2-[[3-(3-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]benzenesulfonamide (PubChem CID 121059394) has the molecular formula C19H14F3N5O3S and a molecular weight of 449.41 g/mol. Its IUPAC name is 2,6-difluoro-N-[2-[[3-(3-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]benzenesulfonamide.
| Compound Name | 2,6-difluoro-N-[2-[[3-(3-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121059394 |
| Molecular Formula | C19H14F3N5O3S |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 2,6-difluoro-N-[2-[[3-(3-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCOc1ccc2nnc(-c3cccc(F)c3)n2n1)c1c(F)cccc1F |
| InChI | InChI=1S/C19H14F3N5O3S/c20-13-4-1-3-12(11-13)19-25-24-16-7-8-17(26-27(16)19)30-10-9-23-31(28,29)18-14(21)5-2-6-15(18)22/h1-8,11,23H,9-10H2 |
| InChIKey | VVNPWYVFKXTIBR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|