C22H20FN9O4 — CID 121058129
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-[2-[[3-(3-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]acetamide (PubChem CID 121058129) has the molecular formula C22H20FN9O4 and a molecular weight of 493.46 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-[2-[[3-(3-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]acetamide.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-[2-[[3-(3-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]acetamide |
|---|---|
| PubChem CID | 121058129 |
| Molecular Formula | C22H20FN9O4 |
| Molecular Weight | 493.46 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-[2-[[3-(3-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]acetamide |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)NCCOc2ccc3nnc(-c4cccc(F)c4)n3n2)n(C)c1=O |
| InChI | InChI=1S/C22H20FN9O4/c1-29-20-18(21(34)30(2)22(29)35)31(12-25-20)11-16(33)24-8-9-36-17-7-6-15-26-27-19(32(15)28-17)13-4-3-5-14(23)10-13/h3-7,10,12H,8-9,11H2,1-2H3,(H,24,33) |
| InChIKey | CMSAJOQUXZQFJE-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 143.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.46 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|