C19H18FN7O2S — CID 121058107
N-[2-[[3-(3-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-4-propylthiadiazole-5-carboxamide (PubChem CID 121058107) has the molecular formula C19H18FN7O2S and a molecular weight of 427.47 g/mol. Its IUPAC name is N-[2-[[3-(3-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-4-propylthiadiazole-5-carboxamide.
| Compound Name | N-[2-[[3-(3-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-4-propylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 121058107 |
| Molecular Formula | C19H18FN7O2S |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | N-[2-[[3-(3-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-4-propylthiadiazole-5-carboxamide |
| SMILES | CCCc1nnsc1C(=O)NCCOc1ccc2nnc(-c3cccc(F)c3)n2n1 |
| InChI | InChI=1S/C19H18FN7O2S/c1-2-4-14-17(30-26-22-14)19(28)21-9-10-29-16-8-7-15-23-24-18(27(15)25-16)12-5-3-6-13(20)11-12/h3,5-8,11H,2,4,9-10H2,1H3,(H,21,28) |
| InChIKey | ZWUOPJMYJBPMJN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|