C20H21NO5S — CID 35395703
2,5-dimethoxy-N-(2-naphthalen-2-yloxyethyl)benzenesulfonamide (PubChem CID 35395703) has the molecular formula C20H21NO5S and a molecular weight of 387.46 g/mol. Its IUPAC name is 2,5-dimethoxy-N-(2-naphthalen-2-yloxyethyl)benzenesulfonamide.
| Compound Name | 2,5-dimethoxy-N-(2-naphthalen-2-yloxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 35395703 |
| Molecular Formula | C20H21NO5S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 2,5-dimethoxy-N-(2-naphthalen-2-yloxyethyl)benzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NCCOc2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C20H21NO5S/c1-24-17-9-10-19(25-2)20(14-17)27(22,23)21-11-12-26-18-8-7-15-5-3-4-6-16(15)13-18/h3-10,13-14,21H,11-12H2,1-2H3 |
| InChIKey | GBVDYDCYDHEAPW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|