C17H19NO7S — CID 30366359
N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2,5-dimethoxybenzenesulfonamide (PubChem CID 30366359) has the molecular formula C17H19NO7S and a molecular weight of 381.41 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 30366359 |
| Molecular Formula | C17H19NO7S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2,5-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NCCOc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C17H19NO7S/c1-21-12-3-6-15(22-2)17(10-12)26(19,20)18-7-8-23-13-4-5-14-16(9-13)25-11-24-14/h3-6,9-10,18H,7-8,11H2,1-2H3 |
| InChIKey | JVIGYWMHFLPDDQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|