C20H22N2O4S — CID 113102226
2-methoxy-4,5-dimethyl-N-(2-quinolin-6-yloxyethyl)benzenesulfonamide (PubChem CID 113102226) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is 2-methoxy-4,5-dimethyl-N-(2-quinolin-6-yloxyethyl)benzenesulfonamide.
| Compound Name | 2-methoxy-4,5-dimethyl-N-(2-quinolin-6-yloxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 113102226 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 2-methoxy-4,5-dimethyl-N-(2-quinolin-6-yloxyethyl)benzenesulfonamide |
| SMILES | COc1cc(C)c(C)cc1S(=O)(=O)NCCOc1ccc2ncccc2c1 |
| InChI | InChI=1S/C20H22N2O4S/c1-14-11-19(25-3)20(12-15(14)2)27(23,24)22-9-10-26-17-6-7-18-16(13-17)5-4-8-21-18/h4-8,11-13,22H,9-10H2,1-3H3 |
| InChIKey | WFSSLJHKAKVRRH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|