C19H22F3NO5S — CID 30366154
2,4-diethoxy-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]benzenesulfonamide (PubChem CID 30366154) has the molecular formula C19H22F3NO5S and a molecular weight of 433.45 g/mol. Its IUPAC name is 2,4-diethoxy-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]benzenesulfonamide.
| Compound Name | 2,4-diethoxy-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 30366154 |
| Molecular Formula | C19H22F3NO5S |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 2,4-diethoxy-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCCOc2cccc(C(F)(F)F)c2)c(OCC)c1 |
| InChI | InChI=1S/C19H22F3NO5S/c1-3-26-16-8-9-18(17(13-16)27-4-2)29(24,25)23-10-11-28-15-7-5-6-14(12-15)19(20,21)22/h5-9,12-13,23H,3-4,10-11H2,1-2H3 |
| InChIKey | NJAAUFGPQQATNF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|