C17H17ClF3NO4S — CID 30366267
2-chloro-N-[2-(4-ethoxyphenoxy)ethyl]-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 30366267) has the molecular formula C17H17ClF3NO4S and a molecular weight of 423.84 g/mol. Its IUPAC name is 2-chloro-N-[2-(4-ethoxyphenoxy)ethyl]-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-chloro-N-[2-(4-ethoxyphenoxy)ethyl]-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 30366267 |
| Molecular Formula | C17H17ClF3NO4S |
| Molecular Weight | 423.84 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | 2-chloro-N-[2-(4-ethoxyphenoxy)ethyl]-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCOc1ccc(OCCNS(=O)(=O)c2cc(C(F)(F)F)ccc2Cl)cc1 |
| InChI | InChI=1S/C17H17ClF3NO4S/c1-2-25-13-4-6-14(7-5-13)26-10-9-22-27(23,24)16-11-12(17(19,20)21)3-8-15(16)18/h3-8,11,22H,2,9-10H2,1H3 |
| InChIKey | OTQYUOGUAJGPEC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.84 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|