C12H15ClF3NO4S — CID 86989290
2-chloro-N-[2-(2-methoxyethoxy)ethyl]-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 86989290) has the molecular formula C12H15ClF3NO4S and a molecular weight of 361.77 g/mol. Its IUPAC name is 2-chloro-N-[2-(2-methoxyethoxy)ethyl]-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-chloro-N-[2-(2-methoxyethoxy)ethyl]-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 86989290 |
| Molecular Formula | C12H15ClF3NO4S |
| Molecular Weight | 361.77 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 2-chloro-N-[2-(2-methoxyethoxy)ethyl]-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | COCCOCCNS(=O)(=O)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C12H15ClF3NO4S/c1-20-6-7-21-5-4-17-22(18,19)11-8-9(12(14,15)16)2-3-10(11)13/h2-3,8,17H,4-7H2,1H3 |
| InChIKey | FCJVVCSWEHFNKH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.77 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|