C14H12ClF3N2O3S — CID 35389490
2-chloro-N-[(2-methoxy-3-pyridinyl)methyl]-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 35389490) has the molecular formula C14H12ClF3N2O3S and a molecular weight of 380.78 g/mol. Its IUPAC name is 2-chloro-N-[(2-methoxy-3-pyridinyl)methyl]-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-chloro-N-[(2-methoxy-3-pyridinyl)methyl]-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 35389490 |
| Molecular Formula | C14H12ClF3N2O3S |
| Molecular Weight | 380.78 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 2-chloro-N-[(2-methoxy-3-pyridinyl)methyl]-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | COc1ncccc1CNS(=O)(=O)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C14H12ClF3N2O3S/c1-23-13-9(3-2-6-19-13)8-20-24(21,22)12-7-10(14(16,17)18)4-5-11(12)15/h2-7,20H,8H2,1H3 |
| InChIKey | AGXWBIYFINQDJU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.78 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |