C18H13ClF3N3O2S — CID 122262182
2-chloro-N-[(6-phenylpyrimidin-4-yl)methyl]-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 122262182) has the molecular formula C18H13ClF3N3O2S and a molecular weight of 427.84 g/mol. Its IUPAC name is 2-chloro-N-[(6-phenylpyrimidin-4-yl)methyl]-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-chloro-N-[(6-phenylpyrimidin-4-yl)methyl]-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 122262182 |
| Molecular Formula | C18H13ClF3N3O2S |
| Molecular Weight | 427.84 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | 2-chloro-N-[(6-phenylpyrimidin-4-yl)methyl]-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1cc(-c2ccccc2)ncn1)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C18H13ClF3N3O2S/c19-15-7-6-13(18(20,21)22)8-17(15)28(26,27)25-10-14-9-16(24-11-23-14)12-4-2-1-3-5-12/h1-9,11,25H,10H2 |
| InChIKey | UVZUMIFKUZHMOX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.84 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |