C18H16FN3O2S — CID 122262233
4-fluoro-2-methyl-N-[(6-phenylpyrimidin-4-yl)methyl]benzenesulfonamide (PubChem CID 122262233) has the molecular formula C18H16FN3O2S and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-fluoro-2-methyl-N-[(6-phenylpyrimidin-4-yl)methyl]benzenesulfonamide.
| Compound Name | 4-fluoro-2-methyl-N-[(6-phenylpyrimidin-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122262233 |
| Molecular Formula | C18H16FN3O2S |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 4-fluoro-2-methyl-N-[(6-phenylpyrimidin-4-yl)methyl]benzenesulfonamide |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)NCc1cc(-c2ccccc2)ncn1 |
| InChI | InChI=1S/C18H16FN3O2S/c1-13-9-15(19)7-8-18(13)25(23,24)22-11-16-10-17(21-12-20-16)14-5-3-2-4-6-14/h2-10,12,22H,11H2,1H3 |
| InChIKey | MNWIOEZMKPKMPI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |