C22H19N3O3S — CID 122262719
N-[[6-(4-methoxyphenyl)pyrimidin-4-yl]methyl]naphthalene-1-sulfonamide (PubChem CID 122262719) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is N-[[6-(4-methoxyphenyl)pyrimidin-4-yl]methyl]naphthalene-1-sulfonamide.
| Compound Name | N-[[6-(4-methoxyphenyl)pyrimidin-4-yl]methyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 122262719 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N-[[6-(4-methoxyphenyl)pyrimidin-4-yl]methyl]naphthalene-1-sulfonamide |
| SMILES | COc1ccc(-c2cc(CNS(=O)(=O)c3cccc4ccccc34)ncn2)cc1 |
| InChI | InChI=1S/C22H19N3O3S/c1-28-19-11-9-17(10-12-19)21-13-18(23-15-24-21)14-25-29(26,27)22-8-4-6-16-5-2-3-7-20(16)22/h2-13,15,25H,14H2,1H3 |
| InChIKey | OUXFFVPDIPFZSB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |