C21H16FN3O2S — CID 122263168
N-[[6-(4-fluorophenyl)pyrimidin-4-yl]methyl]naphthalene-2-sulfonamide (PubChem CID 122263168) has the molecular formula C21H16FN3O2S and a molecular weight of 393.44 g/mol. Its IUPAC name is N-[[6-(4-fluorophenyl)pyrimidin-4-yl]methyl]naphthalene-2-sulfonamide.
| Compound Name | N-[[6-(4-fluorophenyl)pyrimidin-4-yl]methyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 122263168 |
| Molecular Formula | C21H16FN3O2S |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | N-[[6-(4-fluorophenyl)pyrimidin-4-yl]methyl]naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(NCc1cc(-c2ccc(F)cc2)ncn1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H16FN3O2S/c22-18-8-5-16(6-9-18)21-12-19(23-14-24-21)13-25-28(26,27)20-10-7-15-3-1-2-4-17(15)11-20/h1-12,14,25H,13H2 |
| InChIKey | FJPMBMGZBBSAGC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |