C17H13Cl2N3O2S — CID 122262163
2,5-dichloro-N-[(6-phenylpyrimidin-4-yl)methyl]benzenesulfonamide (PubChem CID 122262163) has the molecular formula C17H13Cl2N3O2S and a molecular weight of 394.28 g/mol. Its IUPAC name is 2,5-dichloro-N-[(6-phenylpyrimidin-4-yl)methyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[(6-phenylpyrimidin-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122262163 |
| Molecular Formula | C17H13Cl2N3O2S |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 2,5-dichloro-N-[(6-phenylpyrimidin-4-yl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1cc(-c2ccccc2)ncn1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H13Cl2N3O2S/c18-13-6-7-15(19)17(8-13)25(23,24)22-10-14-9-16(21-11-20-14)12-4-2-1-3-5-12/h1-9,11,22H,10H2 |
| InChIKey | ZHEBKMKJMKYFOX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |