C12H17ClN2O4S2 — CID 80695694
4-chloro-3-[2-(2-methoxyethoxy)ethylsulfamoyl]benzenecarbothioamide (PubChem CID 80695694) has the molecular formula C12H17ClN2O4S2 and a molecular weight of 352.87 g/mol. Its IUPAC name is 4-chloro-3-[2-(2-methoxyethoxy)ethylsulfamoyl]benzenecarbothioamide.
| Compound Name | 4-chloro-3-[2-(2-methoxyethoxy)ethylsulfamoyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 80695694 |
| Molecular Formula | C12H17ClN2O4S2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 4-chloro-3-[2-(2-methoxyethoxy)ethylsulfamoyl]benzenecarbothioamide |
| SMILES | COCCOCCNS(=O)(=O)c1cc(C(N)=S)ccc1Cl |
| InChI | InChI=1S/C12H17ClN2O4S2/c1-18-6-7-19-5-4-15-21(16,17)11-8-9(12(14)20)2-3-10(11)13/h2-3,8,15H,4-7H2,1H3,(H2,14,20) |
| InChIKey | MFGDJQXGZTYGGZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|