C12H16ClN3O3S2 — CID 106277456
3-[(5-carbamothioyl-2-chlorophenyl)sulfonylamino]-2,2-dimethylpropanamide (PubChem CID 106277456) has the molecular formula C12H16ClN3O3S2 and a molecular weight of 349.87 g/mol. Its IUPAC name is 3-[(5-carbamothioyl-2-chlorophenyl)sulfonylamino]-2,2-dimethylpropanamide.
| Compound Name | 3-[(5-carbamothioyl-2-chlorophenyl)sulfonylamino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 106277456 |
| Molecular Formula | C12H16ClN3O3S2 |
| Molecular Weight | 349.87 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 3-[(5-carbamothioyl-2-chlorophenyl)sulfonylamino]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CNS(=O)(=O)c1cc(C(N)=S)ccc1Cl)C(N)=O |
| InChI | InChI=1S/C12H16ClN3O3S2/c1-12(2,11(15)17)6-16-21(18,19)9-5-7(10(14)20)3-4-8(9)13/h3-5,16H,6H2,1-2H3,(H2,14,20)(H2,15,17) |
| InChIKey | FDXZKRIDZZIXEG-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.87 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|