C15H19ClF3NO4S — CID 4984455
tert-butyl 4-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]butanoate (PubChem CID 4984455) has the molecular formula C15H19ClF3NO4S and a molecular weight of 401.83 g/mol. Its IUPAC name is tert-butyl 4-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]butanoate.
| Compound Name | tert-butyl 4-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]butanoate |
|---|---|
| PubChem CID | 4984455 |
| Molecular Formula | C15H19ClF3NO4S |
| Molecular Weight | 401.83 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | tert-butyl 4-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCNS(=O)(=O)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C15H19ClF3NO4S/c1-14(2,3)24-13(21)5-4-8-20-25(22,23)12-9-10(15(17,18)19)6-7-11(12)16/h6-7,9,20H,4-5,8H2,1-3H3 |
| InChIKey | ZLJNZMZJLSFAGT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.83 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|