C20H34NO+ — CID 2182858
(3S,5S)-3,5-dimethyl-1-[4-(2,4,6-trimethylphenoxy)butyl]piperidin-1-ium (PubChem CID 2182858) has the molecular formula C20H34NO+ and a molecular weight of 304.50 g/mol. Its IUPAC name is (3S,5S)-3,5-dimethyl-1-[4-(2,4,6-trimethylphenoxy)butyl]piperidin-1-ium.
| Compound Name | (3S,5S)-3,5-dimethyl-1-[4-(2,4,6-trimethylphenoxy)butyl]piperidin-1-ium |
|---|---|
| PubChem CID | 2182858 |
| Molecular Formula | C20H34NO+ |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | (3S,5S)-3,5-dimethyl-1-[4-(2,4,6-trimethylphenoxy)butyl]piperidin-1-ium |
| SMILES | Cc1cc(C)c(OCCCC[NH+]2C[C@@H](C)C[C@H](C)C2)c(C)c1 |
| InChI | InChI=1S/C20H33NO/c1-15-11-18(4)20(19(5)12-15)22-9-7-6-8-21-13-16(2)10-17(3)14-21/h11-12,16-17H,6-10,13-14H2,1-5H3/p+1/t16-,17-/m0/s1 |
| InChIKey | NAQIZGMKQAIMPZ-IRXDYDNUSA-O |
| XLogP | 3.33 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|