C18H28BrNO2 — CID 2269669
1-[2-[2-(2-bromo-4,6-dimethylphenoxy)ethoxy]ethyl]-4-methylpiperidine (PubChem CID 2269669) has the molecular formula C18H28BrNO2 and a molecular weight of 370.33 g/mol. Its IUPAC name is 1-[2-[2-(2-bromo-4,6-dimethylphenoxy)ethoxy]ethyl]-4-methylpiperidine.
| Compound Name | 1-[2-[2-(2-bromo-4,6-dimethylphenoxy)ethoxy]ethyl]-4-methylpiperidine |
|---|---|
| PubChem CID | 2269669 |
| Molecular Formula | C18H28BrNO2 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 1-[2-[2-(2-bromo-4,6-dimethylphenoxy)ethoxy]ethyl]-4-methylpiperidine |
| SMILES | Cc1cc(C)c(OCCOCCN2CCC(C)CC2)c(Br)c1 |
| InChI | InChI=1S/C18H28BrNO2/c1-14-4-6-20(7-5-14)8-9-21-10-11-22-18-16(3)12-15(2)13-17(18)19/h12-14H,4-11H2,1-3H3 |
| InChIKey | DQIWFQSBRMSSBW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|