C22H30NO3+ — CID 2147684
(2R)-1-[2-(2,6-dimethylphenoxy)ethoxy]-3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propan-2-ol (PubChem CID 2147684) has the molecular formula C22H30NO3+ and a molecular weight of 356.49 g/mol. Its IUPAC name is (2R)-1-[2-(2,6-dimethylphenoxy)ethoxy]-3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propan-2-ol.
| Compound Name | (2R)-1-[2-(2,6-dimethylphenoxy)ethoxy]-3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 2147684 |
| Molecular Formula | C22H30NO3+ |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | (2R)-1-[2-(2,6-dimethylphenoxy)ethoxy]-3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propan-2-ol |
| SMILES | Cc1cccc(C)c1OCCOC[C@H](O)C[NH+]1CCc2ccccc2C1 |
| InChI | InChI=1S/C22H29NO3/c1-17-6-5-7-18(2)22(17)26-13-12-25-16-21(24)15-23-11-10-19-8-3-4-9-20(19)14-23/h3-9,21,24H,10-16H2,1-2H3/p+1/t21-/m1/s1 |
| InChIKey | XFFOGMZQYMPZRR-OAQYLSRUSA-O |
| XLogP | 1.70 |
| TPSA | 43.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|