C17H29BrN2O4+2 — CID 7424723
(2S)-1-[2-(2-bromophenoxy)ethoxy]-3-[4-(2-hydroxyethyl)piperazine-1,4-diium-1-yl]propan-2-ol (PubChem CID 7424723) has the molecular formula C17H29BrN2O4+2 and a molecular weight of 405.33 g/mol. Its IUPAC name is (2S)-1-[2-(2-bromophenoxy)ethoxy]-3-[4-(2-hydroxyethyl)piperazine-1,4-diium-1-yl]propan-2-ol.
| Compound Name | (2S)-1-[2-(2-bromophenoxy)ethoxy]-3-[4-(2-hydroxyethyl)piperazine-1,4-diium-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 7424723 |
| Molecular Formula | C17H29BrN2O4+2 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | (2S)-1-[2-(2-bromophenoxy)ethoxy]-3-[4-(2-hydroxyethyl)piperazine-1,4-diium-1-yl]propan-2-ol |
| SMILES | OCC[NH+]1CC[NH+](C[C@H](O)COCCOc2ccccc2Br)CC1 |
| InChI | InChI=1S/C17H27BrN2O4/c18-16-3-1-2-4-17(16)24-12-11-23-14-15(22)13-20-7-5-19(6-8-20)9-10-21/h1-4,15,21-22H,5-14H2/p+2/t15-/m0/s1 |
| InChIKey | JSXOYSCSKQJANK-HNNXBMFYSA-P |
| XLogP | -2.02 |
| TPSA | 67.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|