C17H25BrNO4+ — CID 7124046
ethyl 1-[(2R)-3-(2-bromophenoxy)-2-hydroxypropyl]piperidin-1-ium-4-carboxylate (PubChem CID 7124046) has the molecular formula C17H25BrNO4+ and a molecular weight of 387.29 g/mol. Its IUPAC name is ethyl 1-[(2R)-3-(2-bromophenoxy)-2-hydroxypropyl]piperidin-1-ium-4-carboxylate.
| Compound Name | ethyl 1-[(2R)-3-(2-bromophenoxy)-2-hydroxypropyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 7124046 |
| Molecular Formula | C17H25BrNO4+ |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | ethyl 1-[(2R)-3-(2-bromophenoxy)-2-hydroxypropyl]piperidin-1-ium-4-carboxylate |
| SMILES | CCOC(=O)C1CC[NH+](C[C@@H](O)COc2ccccc2Br)CC1 |
| InChI | InChI=1S/C17H24BrNO4/c1-2-22-17(21)13-7-9-19(10-8-13)11-14(20)12-23-16-6-4-3-5-15(16)18/h3-6,13-14,20H,2,7-12H2,1H3/p+1/t14-/m1/s1 |
| InChIKey | QBTBAMPELUQGDE-CQSZACIVSA-O |
| XLogP | 1.05 |
| TPSA | 60.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |