C18H28NO4+ — CID 7150366
ethyl (3R)-1-[(2S)-2-hydroxy-3-(2-methylphenoxy)propyl]piperidin-1-ium-3-carboxylate (PubChem CID 7150366) has the molecular formula C18H28NO4+ and a molecular weight of 322.42 g/mol. Its IUPAC name is ethyl (3R)-1-[(2S)-2-hydroxy-3-(2-methylphenoxy)propyl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3R)-1-[(2S)-2-hydroxy-3-(2-methylphenoxy)propyl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 7150366 |
| Molecular Formula | C18H28NO4+ |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | ethyl (3R)-1-[(2S)-2-hydroxy-3-(2-methylphenoxy)propyl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCC[NH+](C[C@H](O)COc2ccccc2C)C1 |
| InChI | InChI=1S/C18H27NO4/c1-3-22-18(21)15-8-6-10-19(11-15)12-16(20)13-23-17-9-5-4-7-14(17)2/h4-5,7,9,15-16,20H,3,6,8,10-13H2,1-2H3/p+1/t15-,16+/m1/s1 |
| InChIKey | IKTWWBOPIQJMLJ-CVEARBPZSA-O |
| XLogP | 0.59 |
| TPSA | 60.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |