C20H30NO5+ — CID 6977814
ethyl 1-[(2R)-2-hydroxy-3-(4-propanoylphenoxy)propyl]piperidin-1-ium-4-carboxylate (PubChem CID 6977814) has the molecular formula C20H30NO5+ and a molecular weight of 364.46 g/mol. Its IUPAC name is ethyl 1-[(2R)-2-hydroxy-3-(4-propanoylphenoxy)propyl]piperidin-1-ium-4-carboxylate.
| Compound Name | ethyl 1-[(2R)-2-hydroxy-3-(4-propanoylphenoxy)propyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 6977814 |
| Molecular Formula | C20H30NO5+ |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | ethyl 1-[(2R)-2-hydroxy-3-(4-propanoylphenoxy)propyl]piperidin-1-ium-4-carboxylate |
| SMILES | CCOC(=O)C1CC[NH+](C[C@@H](O)COc2ccc(C(=O)CC)cc2)CC1 |
| InChI | InChI=1S/C20H29NO5/c1-3-19(23)15-5-7-18(8-6-15)26-14-17(22)13-21-11-9-16(10-12-21)20(24)25-4-2/h5-8,16-17,22H,3-4,9-14H2,1-2H3/p+1/t17-/m1/s1 |
| InChIKey | WENNAAINPATABD-QGZVFWFLSA-O |
| XLogP | 0.88 |
| TPSA | 77.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |