C23H39N2O3+ — CID 7111348
(2R)-1-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]oxypropan-2-ol (PubChem CID 7111348) has the molecular formula C23H39N2O3+ and a molecular weight of 391.58 g/mol. Its IUPAC name is (2R)-1-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]oxypropan-2-ol.
| Compound Name | (2R)-1-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]oxypropan-2-ol |
|---|---|
| PubChem CID | 7111348 |
| Molecular Formula | C23H39N2O3+ |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.30 |
| IUPAC Name | (2R)-1-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]oxypropan-2-ol |
| SMILES | COc1ccc(N2CC[NH+](C[C@@H](O)CO[C@@H]3C[C@H](C)CC(C)(C)C3)CC2)cc1 |
| InChI | InChI=1S/C23H38N2O3/c1-18-13-22(15-23(2,3)14-18)28-17-20(26)16-24-9-11-25(12-10-24)19-5-7-21(27-4)8-6-19/h5-8,18,20,22,26H,9-17H2,1-4H3/p+1/t18-,20+,22+/m0/s1 |
| InChIKey | UBJHMGJIUMQJAG-CZTZKLFOSA-O |
| XLogP | 1.99 |
| TPSA | 46.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|