C22H36FN2OS+ — CID 7087434
(2R)-1-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]-3-[(1S,5R)-3,3,5-trimethylcyclohexyl]oxypropane-2-thiol (PubChem CID 7087434) has the molecular formula C22H36FN2OS+ and a molecular weight of 395.61 g/mol. Its IUPAC name is (2R)-1-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]-3-[(1S,5R)-3,3,5-trimethylcyclohexyl]oxypropane-2-thiol.
| Compound Name | (2R)-1-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]-3-[(1S,5R)-3,3,5-trimethylcyclohexyl]oxypropane-2-thiol |
|---|---|
| PubChem CID | 7087434 |
| Molecular Formula | C22H36FN2OS+ |
| Molecular Weight | 395.61 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | (2R)-1-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]-3-[(1S,5R)-3,3,5-trimethylcyclohexyl]oxypropane-2-thiol |
| SMILES | C[C@H]1C[C@H](OC[C@H](S)C[NH+]2CCN(c3ccc(F)cc3)CC2)CC(C)(C)C1 |
| InChI | InChI=1S/C22H35FN2OS/c1-17-12-20(14-22(2,3)13-17)26-16-21(27)15-24-8-10-25(11-9-24)19-6-4-18(23)5-7-19/h4-7,17,20-21,27H,8-16H2,1-3H3/p+1/t17-,20-,21+/m0/s1 |
| InChIKey | BTIQAQKFOTYDAV-DZFGPLHGSA-O |
| XLogP | 3.06 |
| TPSA | 16.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.61 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|