C23H40N2OS+2 — CID 7087426
(2R)-1-(4-benzylpiperazine-1,4-diium-1-yl)-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]oxypropane-2-thiol (PubChem CID 7087426) has the molecular formula C23H40N2OS+2 and a molecular weight of 392.65 g/mol. Its IUPAC name is (2R)-1-(4-benzylpiperazine-1,4-diium-1-yl)-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]oxypropane-2-thiol.
| Compound Name | (2R)-1-(4-benzylpiperazine-1,4-diium-1-yl)-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]oxypropane-2-thiol |
|---|---|
| PubChem CID | 7087426 |
| Molecular Formula | C23H40N2OS+2 |
| Molecular Weight | 392.65 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | (2R)-1-(4-benzylpiperazine-1,4-diium-1-yl)-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]oxypropane-2-thiol |
| SMILES | C[C@H]1C[C@@H](OC[C@H](S)C[NH+]2CC[NH+](Cc3ccccc3)CC2)CC(C)(C)C1 |
| InChI | InChI=1S/C23H38N2OS/c1-19-13-21(15-23(2,3)14-19)26-18-22(27)17-25-11-9-24(10-12-25)16-20-7-5-4-6-8-20/h4-8,19,21-22,27H,9-18H2,1-3H3/p+2/t19-,21+,22+/m0/s1 |
| InChIKey | WLDZQMGFZFFYMS-KSEOMHKRSA-P |
| XLogP | 1.50 |
| TPSA | 18.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.65 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|