C17H34N2OS — CID 34065860
(2S)-1-(4-methylpiperazin-1-yl)-3-[(1S,5S)-3,3,5-trimethylcyclohexyl]oxypropane-2-thiol (PubChem CID 34065860) has the molecular formula C17H34N2OS and a molecular weight of 314.54 g/mol. Its IUPAC name is (2S)-1-(4-methylpiperazin-1-yl)-3-[(1S,5S)-3,3,5-trimethylcyclohexyl]oxypropane-2-thiol.
| Compound Name | (2S)-1-(4-methylpiperazin-1-yl)-3-[(1S,5S)-3,3,5-trimethylcyclohexyl]oxypropane-2-thiol |
|---|---|
| PubChem CID | 34065860 |
| Molecular Formula | C17H34N2OS |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | (2S)-1-(4-methylpiperazin-1-yl)-3-[(1S,5S)-3,3,5-trimethylcyclohexyl]oxypropane-2-thiol |
| SMILES | C[C@@H]1C[C@H](OC[C@@H](S)CN2CCN(C)CC2)CC(C)(C)C1 |
| InChI | InChI=1S/C17H34N2OS/c1-14-9-15(11-17(2,3)10-14)20-13-16(21)12-19-7-5-18(4)6-8-19/h14-16,21H,5-13H2,1-4H3/t14-,15+,16+/m1/s1 |
| InChIKey | GIYLELCMDHKFKH-PMPSAXMXSA-N |
| XLogP | 2.76 |
| TPSA | 15.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|